C21H32 — CID 90679571
3-[(1R,2R,6R,7S,8S)-8-tricyclo[5.2.1.02,6]decanyl]tricyclo[5.3.1.03,8]undecane (PubChem CID 90679571) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 3-[(1R,2R,6R,7S,8S)-8-tricyclo[5.2.1.02,6]decanyl]tricyclo[5.3.1.03,8]undecane.
| Compound Name | 3-[(1R,2R,6R,7S,8S)-8-tricyclo[5.2.1.02,6]decanyl]tricyclo[5.3.1.03,8]undecane |
|---|---|
| PubChem CID | 90679571 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 3-[(1R,2R,6R,7S,8S)-8-tricyclo[5.2.1.02,6]decanyl]tricyclo[5.3.1.03,8]undecane |
| SMILES | C1C[C@@H]2[C@H](C1)[C@@H]1C[C@@H]2[C@@H](C23CCCC4CC(CCC42)C3)C1 |
| InChI | InChI=1S/C21H32/c1-4-16-15-10-18(17(16)5-1)20(11-15)21-8-2-3-14-9-13(12-21)6-7-19(14)21/h13-20H,1-12H2/t13?,14?,15-,16-,17-,18+,19?,20+,21?/m1/s1 |
| InChIKey | OVMNUNUTMGIKER-WXLDUIGQSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |