About spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane]
spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] (PubChem CID 69253002) has the molecular formula C19H30O
and a molecular weight of 274.45 g/mol. Its IUPAC name is spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane].
Molecular Properties
| Compound Name | spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] |
| PubChem CID | 69253002 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] |
| SMILES | C1CCC2C(C1)CC1C3CCCC3C2CC12CCCO2 |
| InChI | InChI=1S/C19H30O/c1-2-6-14-13(5-1)11-18-16-8-3-7-15(16)17(14)12-19(18)9-4-10-20-19/h13-18H,1-12H2 |
| InChIKey | RFQGJUMSIOXLDS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane]?
The IUPAC name of spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] (CID 69253002) is spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane].
What is the SMILES notation for spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane]?
The canonical SMILES for spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] is C1CCC2C(C1)CC1C3CCCC3C2CC12CCCO2.
What is the InChIKey of spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane]?
The InChIKey is RFQGJUMSIOXLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O/c1-2-6-14-13(5-1)11-18-16-8-3-7-15(16)17(14)12-19(18)9-4-10-20-19/h13-18H,1-12H2.
What are the key properties of spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane]?
spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] has a molecular weight of 274.45 g/mol, XLogP of 4.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[oxolane-2,16'-tetracyclo[7.5.2.02,7.010,14]hexadecane] is sourced from PubChem (CID 69253002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).