C13H20 — CID 102285377
(8S,9R,10R,12R)-tetracyclo[6.5.0.01,9.010,12]tridecane (PubChem CID 102285377) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (8S,9R,10R,12R)-tetracyclo[6.5.0.01,9.010,12]tridecane.
| Compound Name | (8S,9R,10R,12R)-tetracyclo[6.5.0.01,9.010,12]tridecane |
|---|---|
| PubChem CID | 102285377 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (8S,9R,10R,12R)-tetracyclo[6.5.0.01,9.010,12]tridecane |
| SMILES | C1CCCC23C[C@H]4C[C@H]4[C@@H]2[C@@H]3CC1 |
| InChI | InChI=1S/C13H20/c1-2-4-6-13-8-9-7-10(9)12(13)11(13)5-3-1/h9-12H,1-8H2/t9-,10-,11+,12-,13?/m1/s1 |
| InChIKey | RREAMALNRKSEMR-HENWMNBSSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |