C18H23F5O6S — CID 159002475
1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-1-enoxyadamantane-1-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 159002475) has the molecular formula C18H23F5O6S and a molecular weight of 462.43 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-1-enoxyadamantane-1-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-1-enoxyadamantane-1-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159002475 |
| Molecular Formula | C18H23F5O6S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-1-enoxyadamantane-1-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | CC=COC1(C)C2CC3CC1CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C18H23F5O6S/c1-3-4-28-15(2)11-5-10-6-12(15)9-16(7-10,8-11)14(24)29-13(17(19,20)21)18(22,23)30(25,26)27/h3-4,10-13H,5-9H2,1-2H3,(H,25,26,27) |
| InChIKey | LQFGVAPAHZMJCX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|