C18H20F5O7S- — CID 140678006
1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-2-enoyloxyadamantane-1-carbonyl)oxypropane-1-sulfonate (PubChem CID 140678006) has the molecular formula C18H20F5O7S- and a molecular weight of 475.41 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-2-enoyloxyadamantane-1-carbonyl)oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-2-enoyloxyadamantane-1-carbonyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 140678006 |
| Molecular Formula | C18H20F5O7S- |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(4-methyl-4-prop-2-enoyloxyadamantane-1-carbonyl)oxypropane-1-sulfonate |
| SMILES | C=CC(=O)OC1(C)C2CC3CC1CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C18H21F5O7S/c1-3-12(24)30-15(2)10-4-9-5-11(15)8-16(6-9,7-10)14(25)29-13(17(19,20)21)18(22,23)31(26,27)28/h3,9-11,13H,1,4-8H2,2H3,(H,26,27,28)/p-1 |
| InChIKey | VZXDAZBLDHOESL-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|