C11H18F2O2 — CID 67967114
3,3-difluorobutan-2-yl cyclohexanecarboxylate (PubChem CID 67967114) has the molecular formula C11H18F2O2 and a molecular weight of 220.26 g/mol. Its IUPAC name is 3,3-difluorobutan-2-yl cyclohexanecarboxylate.
| Compound Name | 3,3-difluorobutan-2-yl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 67967114 |
| Molecular Formula | C11H18F2O2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3,3-difluorobutan-2-yl cyclohexanecarboxylate |
| SMILES | CC(OC(=O)C1CCCCC1)C(C)(F)F |
| InChI | InChI=1S/C11H18F2O2/c1-8(11(2,12)13)15-10(14)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | SXWOWJOVGPJPSR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |