C14H24F2O2 — CID 118696020
(4,4-difluoro-3,3-dimethylpentyl) cyclohexanecarboxylate (PubChem CID 118696020) has the molecular formula C14H24F2O2 and a molecular weight of 262.34 g/mol. Its IUPAC name is (4,4-difluoro-3,3-dimethylpentyl) cyclohexanecarboxylate.
| Compound Name | (4,4-difluoro-3,3-dimethylpentyl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 118696020 |
| Molecular Formula | C14H24F2O2 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (4,4-difluoro-3,3-dimethylpentyl) cyclohexanecarboxylate |
| SMILES | CC(F)(F)C(C)(C)CCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H24F2O2/c1-13(2,14(3,15)16)9-10-18-12(17)11-7-5-4-6-8-11/h11H,4-10H2,1-3H3 |
| InChIKey | RJIIMRRJTFEAPD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |