C12H20F3NO2S2 — CID 144560325
[4-(aminodisulfanyl)-3,4,4-trifluoro-3-methylbutyl] cyclohexanecarboxylate (PubChem CID 144560325) has the molecular formula C12H20F3NO2S2 and a molecular weight of 331.43 g/mol. Its IUPAC name is [4-(aminodisulfanyl)-3,4,4-trifluoro-3-methylbutyl] cyclohexanecarboxylate.
| Compound Name | [4-(aminodisulfanyl)-3,4,4-trifluoro-3-methylbutyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 144560325 |
| Molecular Formula | C12H20F3NO2S2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [4-(aminodisulfanyl)-3,4,4-trifluoro-3-methylbutyl] cyclohexanecarboxylate |
| SMILES | CC(F)(CCOC(=O)C1CCCCC1)C(F)(F)SSN |
| InChI | InChI=1S/C12H20F3NO2S2/c1-11(13,12(14,15)19-20-16)7-8-18-10(17)9-5-3-2-4-6-9/h9H,2-8,16H2,1H3 |
| InChIKey | HPIQYOSUBAVKSD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|