About [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate
[(1S)-1-acetyloxyethyl] cyclohexanecarboxylate (PubChem CID 70191604) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate |
| PubChem CID | 70191604 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate |
| SMILES | CC(=O)O[C@H](C)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H18O4/c1-8(12)14-9(2)15-11(13)10-6-4-3-5-7-10/h9-10H,3-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | TYJIHORPCGMWFQ-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate?
The IUPAC name of [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate (CID 70191604) is [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate.
What is the SMILES notation for [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate?
The canonical SMILES for [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate is CC(=O)O[C@H](C)OC(=O)C1CCCCC1.
What is the InChIKey of [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate?
The InChIKey is TYJIHORPCGMWFQ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H18O4/c1-8(12)14-9(2)15-11(13)10-6-4-3-5-7-10/h9-10H,3-7H2,1-2H3/t9-/m0/s1.
What are the key properties of [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate?
[(1S)-1-acetyloxyethyl] cyclohexanecarboxylate has a molecular weight of 214.26 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-acetyloxyethyl] cyclohexanecarboxylate is sourced from PubChem (CID 70191604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).