C9H13F5O4S — CID 87208246
2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 87208246) has the molecular formula C9H13F5O4S and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87208246 |
| Molecular Formula | C9H13F5O4S |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(OC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O4S/c10-8(11,12)7(9(13,14)19(15,16)17)18-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,15,16,17) |
| InChIKey | UGVFAYAIQBOFLK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|