2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid

C9H13F5O4S — CID 87208246

IUPAC2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)C(OC1CCCCC1)C(F)(F)F
InChIInChI=1S/C9H13F5O4S/c10-8(11,12)7(9(13,14)19(15,16)17)18-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,15,16,17)
InChIKeyUGVFAYAIQBOFLK-UHFFFAOYSA-N
MW312.26 g/mol
LogP2.75
Rot. Bonds4

About 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid

2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 87208246) has the molecular formula C9H13F5O4S and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.

Molecular Properties

Compound Name2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
PubChem CID87208246
Molecular FormulaC9H13F5O4S
Molecular Weight312.26 g/mol
Exact Mass312.05
IUPAC Name2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)C(OC1CCCCC1)C(F)(F)F
InChIInChI=1S/C9H13F5O4S/c10-8(11,12)7(9(13,14)19(15,16)17)18-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,15,16,17)
InChIKeyUGVFAYAIQBOFLK-UHFFFAOYSA-N
XLogP2.75
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.26
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The IUPAC name of 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (CID 87208246) is 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
What is the SMILES notation for 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The canonical SMILES for 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid is O=S(=O)(O)C(F)(F)C(OC1CCCCC1)C(F)(F)F.
What is the InChIKey of 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
The InChIKey is UGVFAYAIQBOFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F5O4S/c10-8(11,12)7(9(13,14)19(15,16)17)18-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,15,16,17).
What are the key properties of 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid?
2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid has a molecular weight of 312.26 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid is sourced from PubChem (CID 87208246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).