C17H14F5I4NO6S — CID 164728064
2-[(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)amino]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 164728064) has the molecular formula C17H14F5I4NO6S and a molecular weight of 962.97 g/mol. Its IUPAC name is 2-[(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)amino]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)amino]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 164728064 |
| Molecular Formula | C17H14F5I4NO6S |
| Molecular Weight | 962.97 g/mol |
| Exact Mass | 962.66 |
| IUPAC Name | 2-[(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)amino]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(NC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1c(I)c(I)c(I)c(I)c1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C17H14F5I4NO6S/c18-16(19,20)15(17(21,22)34(30,31)32)27-13(28)7-8(10(24)12(26)11(25)9(7)23)14(29)33-6-4-2-1-3-5-6/h6,15H,1-5H2,(H,27,28)(H,30,31,32) |
| InChIKey | CFFWFHBCLQNJKK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|