C21H12F4I4O6 — CID 153467993
4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 153467993) has the molecular formula C21H12F4I4O6 and a molecular weight of 943.93 g/mol. Its IUPAC name is 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 153467993 |
| Molecular Formula | C21H12F4I4O6 |
| Molecular Weight | 943.93 g/mol |
| Exact Mass | 943.67 |
| IUPAC Name | 4-(2-cyclohexyloxycarbonyl-3,4,5,6-tetraiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(OC(=O)c2c(I)c(I)c(I)c(I)c2C(=O)OC2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C21H12F4I4O6/c22-10-9(19(30)31)11(23)13(25)18(12(10)24)35-21(33)8-7(14(26)16(28)17(29)15(8)27)20(32)34-6-4-2-1-3-5-6/h6H,1-5H2,(H,30,31) |
| InChIKey | MKERHHLJCRNBNR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.93 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|