C14HF4I4O5- — CID 153467994
4-(4-carboxy-2,3,5,6-tetrafluorophenoxy)carbonyl-2,3,5,6-tetraiodophenolate (PubChem CID 153467994) has the molecular formula C14HF4I4O5- and a molecular weight of 832.76 g/mol. Its IUPAC name is 4-(4-carboxy-2,3,5,6-tetrafluorophenoxy)carbonyl-2,3,5,6-tetraiodophenolate.
| Compound Name | 4-(4-carboxy-2,3,5,6-tetrafluorophenoxy)carbonyl-2,3,5,6-tetraiodophenolate |
|---|---|
| PubChem CID | 153467994 |
| Molecular Formula | C14HF4I4O5- |
| Molecular Weight | 832.76 g/mol |
| Exact Mass | 832.59 |
| IUPAC Name | 4-(4-carboxy-2,3,5,6-tetrafluorophenoxy)carbonyl-2,3,5,6-tetraiodophenolate |
| SMILES | O=C(O)c1c(F)c(F)c(OC(=O)c2c(I)c(I)c([O-])c(I)c2I)c(F)c1F |
| InChI | InChI=1S/C14H2F4I4O5/c15-3-1(13(24)25)4(16)6(18)12(5(3)17)27-14(26)2-7(19)9(21)11(23)10(22)8(2)20/h23H,(H,24,25)/p-1 |
| InChIKey | HMUMIVFDQSKMLC-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|