C16H9F4IO4 — CID 174246631
2,3,4,5-tetrafluoro-6-(4-iodo-2,6-dimethylphenoxy)carbonylbenzoic acid (PubChem CID 174246631) has the molecular formula C16H9F4IO4 and a molecular weight of 468.14 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(4-iodo-2,6-dimethylphenoxy)carbonylbenzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(4-iodo-2,6-dimethylphenoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 174246631 |
| Molecular Formula | C16H9F4IO4 |
| Molecular Weight | 468.14 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(4-iodo-2,6-dimethylphenoxy)carbonylbenzoic acid |
| SMILES | Cc1cc(I)cc(C)c1OC(=O)c1c(F)c(F)c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C16H9F4IO4/c1-5-3-7(21)4-6(2)14(5)25-16(24)9-8(15(22)23)10(17)12(19)13(20)11(9)18/h3-4H,1-2H3,(H,22,23) |
| InChIKey | QLHWVOZSUOXYMM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|