C8HF5O4 — CID 150469722
2,3,4,5-tetrafluoro-6-fluorooxycarbonylbenzoic acid (PubChem CID 150469722) has the molecular formula C8HF5O4 and a molecular weight of 256.08 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-fluorooxycarbonylbenzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-fluorooxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 150469722 |
| Molecular Formula | C8HF5O4 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-fluorooxycarbonylbenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)OF |
| InChI | InChI=1S/C8HF5O4/c9-3-1(7(14)15)2(8(16)17-13)4(10)6(12)5(3)11/h(H,14,15) |
| InChIKey | HRNSJDUNUNRMKY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|