C27H24F4O4 — CID 22898020
4-O-[2,6-dimethyl-4-[(3,4,5-trimethylphenyl)methyl]phenyl] 1-O-methyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate (PubChem CID 22898020) has the molecular formula C27H24F4O4 and a molecular weight of 488.48 g/mol. Its IUPAC name is 4-O-[2,6-dimethyl-4-[(3,4,5-trimethylphenyl)methyl]phenyl] 1-O-methyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2,6-dimethyl-4-[(3,4,5-trimethylphenyl)methyl]phenyl] 1-O-methyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 22898020 |
| Molecular Formula | C27H24F4O4 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-O-[2,6-dimethyl-4-[(3,4,5-trimethylphenyl)methyl]phenyl] 1-O-methyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1c(F)c(F)c(C(=O)Oc2c(C)cc(Cc3cc(C)c(C)c(C)c3)cc2C)c(F)c1F |
| InChI | InChI=1S/C27H24F4O4/c1-12-7-17(8-13(2)16(12)5)11-18-9-14(3)25(15(4)10-18)35-27(33)20-23(30)21(28)19(26(32)34-6)22(29)24(20)31/h7-10H,11H2,1-6H3 |
| InChIKey | BDAYFBRJETZJGE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|