C10H12O3 — CID 126987964
cyclopropyl 2,4-dimethylfuran-3-carboxylate (PubChem CID 126987964) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is cyclopropyl 2,4-dimethylfuran-3-carboxylate.
| Compound Name | cyclopropyl 2,4-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 126987964 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | cyclopropyl 2,4-dimethylfuran-3-carboxylate |
| SMILES | Cc1coc(C)c1C(=O)OC1CC1 |
| InChI | InChI=1S/C10H12O3/c1-6-5-12-7(2)9(6)10(11)13-8-3-4-8/h5,8H,3-4H2,1-2H3 |
| InChIKey | XCTJKTLYVOWPDE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |