prop-2-ynyl 2,4-dimethylfuran-3-carboxylate

C10H10O3 — CID 130610567

IUPACprop-2-ynyl 2,4-dimethylfuran-3-carboxylate
SMILESC#CCOC(=O)c1c(C)coc1C
InChIInChI=1S/C10H10O3/c1-4-5-12-10(11)9-7(2)6-13-8(9)3/h1,6H,5H2,2-3H3
InChIKeyLBEROQSGIOYDAR-UHFFFAOYSA-N
MW178.19 g/mol
LogP1.69
Rot. Bonds2

About prop-2-ynyl 2,4-dimethylfuran-3-carboxylate

prop-2-ynyl 2,4-dimethylfuran-3-carboxylate (PubChem CID 130610567) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is prop-2-ynyl 2,4-dimethylfuran-3-carboxylate.

Molecular Properties

Compound Nameprop-2-ynyl 2,4-dimethylfuran-3-carboxylate
PubChem CID130610567
Molecular FormulaC10H10O3
Molecular Weight178.19 g/mol
Exact Mass178.06
IUPAC Nameprop-2-ynyl 2,4-dimethylfuran-3-carboxylate
SMILESC#CCOC(=O)c1c(C)coc1C
InChIInChI=1S/C10H10O3/c1-4-5-12-10(11)9-7(2)6-13-8(9)3/h1,6H,5H2,2-3H3
InChIKeyLBEROQSGIOYDAR-UHFFFAOYSA-N
XLogP1.69
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze prop-2-ynyl 2,4-dimethylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

cyanomethyl 2,4-dimethylfuran-3-carboxylate
CID 130718998
methyl 2,4-dimethylfuran-3-carboxylate
CID 13102221
cyclopropyl 2,4-dimethylfuran-3-carboxylate
CID 126987964
prop-2-ynyl 3-methyl-5-propan-2-yl-1,2-oxazole-4-carboxylate
CID 60593172
prop-2-ynyl 3-methylpyridine-4-carboxylate
CID 131159987
prop-2-ynyl 2-chlorofuran-3-carboxylate
CID 130727677
2,3,4,5-tetrachloro-6-prop-2-ynoxycarbonylbenzoate
CID 7038245
N-ethyl-N,2,4-trimethylfuran-3-carboxamide
CID 131084548
ethyl 4-methyl-2-[(E)-pent-1-enyl]furan-3-carboxylate
CID 11974977
prop-2-ynyl 5-bromothiophene-2-carboxylate
CID 14126968
ethyl 4-acetyl-5-methylfuran-3-carboxylate
CID 135057105
prop-2-ynyl 4-propan-2-ylbenzoate
CID 58591842

Frequently Asked Questions

What is the IUPAC name of prop-2-ynyl 2,4-dimethylfuran-3-carboxylate?
The IUPAC name of prop-2-ynyl 2,4-dimethylfuran-3-carboxylate (CID 130610567) is prop-2-ynyl 2,4-dimethylfuran-3-carboxylate.
What is the SMILES notation for prop-2-ynyl 2,4-dimethylfuran-3-carboxylate?
The canonical SMILES for prop-2-ynyl 2,4-dimethylfuran-3-carboxylate is C#CCOC(=O)c1c(C)coc1C.
What is the InChIKey of prop-2-ynyl 2,4-dimethylfuran-3-carboxylate?
The InChIKey is LBEROQSGIOYDAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-4-5-12-10(11)9-7(2)6-13-8(9)3/h1,6H,5H2,2-3H3.
What are the key properties of prop-2-ynyl 2,4-dimethylfuran-3-carboxylate?
prop-2-ynyl 2,4-dimethylfuran-3-carboxylate has a molecular weight of 178.19 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2,4-dimethylfuran-3-carboxylate is sourced from PubChem (CID 130610567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).