cyanomethyl 2,4-dimethylfuran-3-carboxylate

C9H9NO3 — CID 130718998

IUPACcyanomethyl 2,4-dimethylfuran-3-carboxylate
SMILESCc1coc(C)c1C(=O)OCC#N
InChIInChI=1S/C9H9NO3/c1-6-5-13-7(2)8(6)9(11)12-4-3-10/h5H,4H2,1-2H3
InChIKeyMDGLAEAQODHVEY-UHFFFAOYSA-N
MW179.17 g/mol
LogP1.58
Rot. Bonds2

About cyanomethyl 2,4-dimethylfuran-3-carboxylate

cyanomethyl 2,4-dimethylfuran-3-carboxylate (PubChem CID 130718998) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is cyanomethyl 2,4-dimethylfuran-3-carboxylate.

Molecular Properties

Compound Namecyanomethyl 2,4-dimethylfuran-3-carboxylate
PubChem CID130718998
Molecular FormulaC9H9NO3
Molecular Weight179.17 g/mol
Exact Mass179.06
IUPAC Namecyanomethyl 2,4-dimethylfuran-3-carboxylate
SMILESCc1coc(C)c1C(=O)OCC#N
InChIInChI=1S/C9H9NO3/c1-6-5-13-7(2)8(6)9(11)12-4-3-10/h5H,4H2,1-2H3
InChIKeyMDGLAEAQODHVEY-UHFFFAOYSA-N
XLogP1.58
TPSA63.23 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 51.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze cyanomethyl 2,4-dimethylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

prop-2-ynyl 2,4-dimethylfuran-3-carboxylate
CID 130610567
methyl 2,4-dimethylfuran-3-carboxylate
CID 13102221
cyclopropyl 2,4-dimethylfuran-3-carboxylate
CID 126987964
bis(cyanomethyl) 3,6-diaminopyrazine-2,5-dicarboxylate
CID 15404203
cyanomethyl 3,4,5-trimethoxybenzoate
CID 2681800
N-ethyl-N,2,4-trimethylfuran-3-carboxamide
CID 131084548
cyanomethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate
CID 27194611
ethyl 4-methyl-2-[(E)-pent-1-enyl]furan-3-carboxylate
CID 11974977
cyanomethyl 4-amino-5-methylthiophene-2-carboxylate
CID 61316963
cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate
CID 130676104
ethyl 4-acetyl-5-methylfuran-3-carboxylate
CID 135057105
cyanomethyl 4-cyanobenzoate
CID 147259846

Frequently Asked Questions

What is the IUPAC name of cyanomethyl 2,4-dimethylfuran-3-carboxylate?
The IUPAC name of cyanomethyl 2,4-dimethylfuran-3-carboxylate (CID 130718998) is cyanomethyl 2,4-dimethylfuran-3-carboxylate.
What is the SMILES notation for cyanomethyl 2,4-dimethylfuran-3-carboxylate?
The canonical SMILES for cyanomethyl 2,4-dimethylfuran-3-carboxylate is Cc1coc(C)c1C(=O)OCC#N.
What is the InChIKey of cyanomethyl 2,4-dimethylfuran-3-carboxylate?
The InChIKey is MDGLAEAQODHVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-6-5-13-7(2)8(6)9(11)12-4-3-10/h5H,4H2,1-2H3.
What are the key properties of cyanomethyl 2,4-dimethylfuran-3-carboxylate?
cyanomethyl 2,4-dimethylfuran-3-carboxylate has a molecular weight of 179.17 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 2,4-dimethylfuran-3-carboxylate is sourced from PubChem (CID 130718998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).