About cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate
cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 130676104) has the molecular formula C7H6N2O2S
and a molecular weight of 182.20 g/mol. Its IUPAC name is cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 130676104 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | Cc1nscc1C(=O)OCC#N |
| InChI | InChI=1S/C7H6N2O2S/c1-5-6(4-12-9-5)7(10)11-3-2-8/h4H,3H2,1H3 |
| InChIKey | CLJQVSCXSMKDIR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate (CID 130676104) is cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate is Cc1nscc1C(=O)OCC#N.
What is the InChIKey of cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is CLJQVSCXSMKDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c1-5-6(4-12-9-5)7(10)11-3-2-8/h4H,3H2,1H3.
What are the key properties of cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate?
cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 182.20 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 130676104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).