C10H14F2O7S — CID 58571453
1,1-difluoro-2-(2-formyloxycyclohexanecarbonyl)oxyethanesulfonic acid (PubChem CID 58571453) has the molecular formula C10H14F2O7S and a molecular weight of 316.28 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-formyloxycyclohexanecarbonyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-formyloxycyclohexanecarbonyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58571453 |
| Molecular Formula | C10H14F2O7S |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1,1-difluoro-2-(2-formyloxycyclohexanecarbonyl)oxyethanesulfonic acid |
| SMILES | O=COC1CCCCC1C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H14F2O7S/c11-10(12,20(15,16)17)5-18-9(14)7-3-1-2-4-8(7)19-6-13/h6-8H,1-5H2,(H,15,16,17) |
| InChIKey | TUGKWRRTLZNFTR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|