C10H10F3NO6S2 — CID 164777418
3-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 164777418) has the molecular formula C10H10F3NO6S2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 3-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 164777418 |
| Molecular Formula | C10H10F3NO6S2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)c1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C10H10F3NO6S2/c11-10(12,13)22(17,18)14-21(15,16)9-3-1-2-7(4-9)19-5-8-6-20-8/h1-4,8,14H,5-6H2 |
| InChIKey | IGQHUXGNYYKLKL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|