C18H20O3 — CID 162758464
3-[2-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenol (PubChem CID 162758464) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[2-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenol.
| Compound Name | 3-[2-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 162758464 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[2-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenol |
| SMILES | CC(C)(c1cccc(O)c1)c1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C18H20O3/c1-18(2,13-5-3-7-15(19)9-13)14-6-4-8-16(10-14)20-11-17-12-21-17/h3-10,17,19H,11-12H2,1-2H3 |
| InChIKey | PQSZDGXCHZTFET-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|