C35H42O6 — CID 155228870
2-[[3,5-bis[2-methyl-1-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]methyl]oxirane (PubChem CID 155228870) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is 2-[[3,5-bis[2-methyl-1-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[3,5-bis[2-methyl-1-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 155228870 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 2-[[3,5-bis[2-methyl-1-[3-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]methyl]oxirane |
| SMILES | CC(C)(Cc1cccc(OCC2CO2)c1)c1cc(OCC2CO2)cc(C(C)(C)Cc2cccc(OCC3CO3)c2)c1 |
| InChI | InChI=1S/C35H42O6/c1-34(2,16-24-7-5-9-28(11-24)36-18-31-21-39-31)26-13-27(15-30(14-26)38-20-33-23-41-33)35(3,4)17-25-8-6-10-29(12-25)37-19-32-22-40-32/h5-15,31-33H,16-23H2,1-4H3 |
| InChIKey | FNRRJKBEGJQGBR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|