C11H11F2O6S- — CID 164777735
1,1-difluoro-2-[3-(oxiran-2-ylmethoxy)phenoxy]ethanesulfonate (PubChem CID 164777735) has the molecular formula C11H11F2O6S- and a molecular weight of 309.27 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(oxiran-2-ylmethoxy)phenoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[3-(oxiran-2-ylmethoxy)phenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 164777735 |
| Molecular Formula | C11H11F2O6S- |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 1,1-difluoro-2-[3-(oxiran-2-ylmethoxy)phenoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)COc1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C11H12F2O6S/c12-11(13,20(14,15)16)7-19-9-3-1-2-8(4-9)17-5-10-6-18-10/h1-4,10H,5-7H2,(H,14,15,16)/p-1 |
| InChIKey | UYIDEXYHVYYWDC-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 88.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|