C16H19F3N2O7S — CID 146374465
1-[2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]ethyl]-3-(trifluoromethylsulfonyl)urea (PubChem CID 146374465) has the molecular formula C16H19F3N2O7S and a molecular weight of 440.40 g/mol. Its IUPAC name is 1-[2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]ethyl]-3-(trifluoromethylsulfonyl)urea.
| Compound Name | 1-[2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]ethyl]-3-(trifluoromethylsulfonyl)urea |
|---|---|
| PubChem CID | 146374465 |
| Molecular Formula | C16H19F3N2O7S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-[2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]ethyl]-3-(trifluoromethylsulfonyl)urea |
| SMILES | O=C(NCCc1cc(OCC2CO2)cc(OCC2CO2)c1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O7S/c17-16(18,19)29(23,24)21-15(22)20-2-1-10-3-11(25-6-13-8-27-13)5-12(4-10)26-7-14-9-28-14/h3-5,13-14H,1-2,6-9H2,(H2,20,21,22) |
| InChIKey | RWQIJKVUBVDGME-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|