C18H27NO4 — CID 146374460
5-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-N-methylpentan-1-amine (PubChem CID 146374460) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-N-methylpentan-1-amine.
| Compound Name | 5-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 146374460 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 5-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-N-methylpentan-1-amine |
| SMILES | CNCCCCCc1cc(OCC2CO2)cc(OCC2CO2)c1 |
| InChI | InChI=1S/C18H27NO4/c1-19-6-4-2-3-5-14-7-15(20-10-17-12-22-17)9-16(8-14)21-11-18-13-23-18/h7-9,17-19H,2-6,10-13H2,1H3 |
| InChIKey | XQSZAXJPRSDPPT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|