C16H15F3N2O5S — CID 146374237
[3-prop-2-enoyloxy-5-[2-(trifluoromethylsulfanylcarbamoylamino)ethyl]phenyl] prop-2-enoate (PubChem CID 146374237) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-5-[2-(trifluoromethylsulfanylcarbamoylamino)ethyl]phenyl] prop-2-enoate.
| Compound Name | [3-prop-2-enoyloxy-5-[2-(trifluoromethylsulfanylcarbamoylamino)ethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146374237 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [3-prop-2-enoyloxy-5-[2-(trifluoromethylsulfanylcarbamoylamino)ethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(CCNC(=O)NSC(F)(F)F)cc(OC(=O)C=C)c1 |
| InChI | InChI=1S/C16H15F3N2O5S/c1-3-13(22)25-11-7-10(8-12(9-11)26-14(23)4-2)5-6-20-15(24)21-27-16(17,18)19/h3-4,7-9H,1-2,5-6H2,(H2,20,21,24) |
| InChIKey | AVADYLNWBUPXDE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|