C17H16F3NO5S — CID 146374443
[3-(2-methylprop-2-enoyloxy)-5-[2-oxo-2-(trifluoromethylsulfanylamino)ethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 146374443) has the molecular formula C17H16F3NO5S and a molecular weight of 403.38 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-5-[2-oxo-2-(trifluoromethylsulfanylamino)ethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-5-[2-oxo-2-(trifluoromethylsulfanylamino)ethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146374443 |
| Molecular Formula | C17H16F3NO5S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-5-[2-oxo-2-(trifluoromethylsulfanylamino)ethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(CC(=O)NSC(F)(F)F)cc(OC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C17H16F3NO5S/c1-9(2)15(23)25-12-5-11(7-14(22)21-27-17(18,19)20)6-13(8-12)26-16(24)10(3)4/h5-6,8H,1,3,7H2,2,4H3,(H,21,22) |
| InChIKey | IVVIPBHUCRNHEC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|