C42H40O7 — CID 130280939
[4-[4-[4-[3-(3,3-dimethyl-2-oxobutyl)-5-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 130280939) has the molecular formula C42H40O7 and a molecular weight of 656.77 g/mol. Its IUPAC name is [4-[4-[4-[3-(3,3-dimethyl-2-oxobutyl)-5-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-[3-(3,3-dimethyl-2-oxobutyl)-5-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130280939 |
| Molecular Formula | C42H40O7 |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [4-[4-[4-[3-(3,3-dimethyl-2-oxobutyl)-5-(2-methylprop-2-enoyloxy)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(CC(=O)C(C)(C)C)cc(-c2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)c(OC(=O)C(=C)C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C42H40O7/c1-25(2)39(44)47-35-21-28(22-38(43)42(7,8)9)20-34(23-35)32-16-12-30(13-17-32)29-10-14-31(15-11-29)33-18-19-36(48-40(45)26(3)4)37(24-33)49-41(46)27(5)6/h10-21,23-24H,1,3,5,22H2,2,4,6-9H3 |
| InChIKey | SAXZVQLUJOBEOW-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|