C17H17F9O4 — CID 158983898
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate;methane (PubChem CID 158983898) has the molecular formula C17H17F9O4 and a molecular weight of 456.30 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate;methane.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate;methane |
|---|---|
| PubChem CID | 158983898 |
| Molecular Formula | C17H17F9O4 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate;methane |
| SMILES | C.C=C(C)C(=O)Oc1cc(C(C)(O)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F9O4.CH4/c1-7(2)11(26)29-10-5-8(12(3,27)14(17,18)19)4-9(6-10)13(28,15(20,21)22)16(23,24)25;/h4-6,27-28H,1H2,2-3H3;1H4 |
| InChIKey | JPIGXJGKIXPLES-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|