C31H30O8 — CID 163418852
[3-[2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2,2-dimethylpropanoate (PubChem CID 163418852) has the molecular formula C31H30O8 and a molecular weight of 530.57 g/mol. Its IUPAC name is [3-[2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163418852 |
| Molecular Formula | C31H30O8 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | [3-[2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1cc(C#Cc2cc(OC(=O)C(=C)C)cc(OC(=O)C(C)(C)C)c2)cc(OC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C31H30O8/c1-18(2)27(32)36-23-12-21(13-24(16-23)37-28(33)19(3)4)10-11-22-14-25(38-29(34)20(5)6)17-26(15-22)39-30(35)31(7,8)9/h12-17H,1,3,5H2,2,4,6-9H3 |
| InChIKey | AGSRTYWSBDOALP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|