C23H26O6 — CID 135157812
[3-hydroxy-5-[[2-methyl-5-(2-methylprop-2-enoyloxy)phenoxy]methyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 135157812) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is [3-hydroxy-5-[[2-methyl-5-(2-methylprop-2-enoyloxy)phenoxy]methyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-hydroxy-5-[[2-methyl-5-(2-methylprop-2-enoyloxy)phenoxy]methyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135157812 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [3-hydroxy-5-[[2-methyl-5-(2-methylprop-2-enoyloxy)phenoxy]methyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C)c(OCc2cc(O)cc(OC(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C23H26O6/c1-14(2)21(25)28-18-8-7-15(3)20(12-18)27-13-16-9-17(24)11-19(10-16)29-22(26)23(4,5)6/h7-12,24H,1,13H2,2-6H3 |
| InChIKey | CVSZOLJKZPMDEU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|