C22H22O4 — CID 123333199
3-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]prop-2-ynyl 2,2-dimethylpropanoate (PubChem CID 123333199) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]prop-2-ynyl 2,2-dimethylpropanoate.
| Compound Name | 3-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]prop-2-ynyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123333199 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[6-(2-methylprop-2-enoyloxy)naphthalen-2-yl]prop-2-ynyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)Oc1ccc2cc(C#CCOC(=O)C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C22H22O4/c1-15(2)20(23)26-19-11-10-17-13-16(8-9-18(17)14-19)7-6-12-25-21(24)22(3,4)5/h8-11,13-14H,1,12H2,2-5H3 |
| InChIKey | ICVXHNXEHLXLOI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|