C21H16O2 — CID 123764756
3-phenanthren-2-ylprop-2-ynyl 2-methylprop-2-enoate (PubChem CID 123764756) has the molecular formula C21H16O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-phenanthren-2-ylprop-2-ynyl 2-methylprop-2-enoate.
| Compound Name | 3-phenanthren-2-ylprop-2-ynyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123764756 |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-phenanthren-2-ylprop-2-ynyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC#Cc1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C21H16O2/c1-15(2)21(22)23-13-5-6-16-9-12-20-18(14-16)11-10-17-7-3-4-8-19(17)20/h3-4,7-12,14H,1,13H2,2H3 |
| InChIKey | PTXNNRZHSBHKCJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|