C19H18Si — CID 131953552
trimethyl(2-phenanthren-2-ylethynyl)silane (PubChem CID 131953552) has the molecular formula C19H18Si and a molecular weight of 274.44 g/mol. Its IUPAC name is trimethyl(2-phenanthren-2-ylethynyl)silane.
| Compound Name | trimethyl(2-phenanthren-2-ylethynyl)silane |
|---|---|
| PubChem CID | 131953552 |
| Molecular Formula | C19H18Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | trimethyl(2-phenanthren-2-ylethynyl)silane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C19H18Si/c1-20(2,3)13-12-15-8-11-19-17(14-15)10-9-16-6-4-5-7-18(16)19/h4-11,14H,1-3H3 |
| InChIKey | HTEAAVOOHGCMDJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|