C64H54O4Si2 — CID 162405850
2-[7-[13-[9,10-dimethoxy-7-(2-trimethylsilylethynyl)phenanthren-2-yl]pentacen-6-yl]-9,10-dimethoxyphenanthren-2-yl]ethynyl-trimethylsilane (PubChem CID 162405850) has the molecular formula C64H54O4Si2 and a molecular weight of 943.30 g/mol. Its IUPAC name is 2-[7-[13-[9,10-dimethoxy-7-(2-trimethylsilylethynyl)phenanthren-2-yl]pentacen-6-yl]-9,10-dimethoxyphenanthren-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[7-[13-[9,10-dimethoxy-7-(2-trimethylsilylethynyl)phenanthren-2-yl]pentacen-6-yl]-9,10-dimethoxyphenanthren-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 162405850 |
| Molecular Formula | C64H54O4Si2 |
| Molecular Weight | 943.30 g/mol |
| Exact Mass | 942.36 |
| IUPAC Name | 2-[7-[13-[9,10-dimethoxy-7-(2-trimethylsilylethynyl)phenanthren-2-yl]pentacen-6-yl]-9,10-dimethoxyphenanthren-2-yl]ethynyl-trimethylsilane |
| SMILES | COc1c(OC)c2cc(-c3c4cc5ccccc5cc4c(-c4ccc5c(c4)c(OC)c(OC)c4cc(C#C[Si](C)(C)C)ccc45)c4cc5ccccc5cc34)ccc2c2ccc(C#C[Si](C)(C)C)cc12 |
| InChI | InChI=1S/C64H54O4Si2/c1-65-61-55-31-39(27-29-69(5,6)7)19-23-47(55)49-25-21-45(37-57(49)63(61)67-3)59-51-33-41-15-11-13-17-43(41)35-53(51)60(54-36-44-18-14-12-16-42(44)34-52(54)59)46-22-26-50-48-24-20-40(28-30-70(8,9)10)32-56(48)62(66-2)64(68-4)58(50)38-46/h11-26,31-38H,1-10H3 |
| InChIKey | MXLLGSUELAUSDV-UHFFFAOYSA-N |
| XLogP | 16.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.30 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|