C27H20S2Si — CID 177481423
2-(12,24-dithiahexacyclo[11.11.0.02,11.04,9.014,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16,18,20,22-undecaen-7-yl)ethynyl-trimethylsilane (PubChem CID 177481423) has the molecular formula C27H20S2Si and a molecular weight of 436.68 g/mol. Its IUPAC name is 2-(12,24-dithiahexacyclo[11.11.0.02,11.04,9.014,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16,18,20,22-undecaen-7-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(12,24-dithiahexacyclo[11.11.0.02,11.04,9.014,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16,18,20,22-undecaen-7-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 177481423 |
| Molecular Formula | C27H20S2Si |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 2-(12,24-dithiahexacyclo[11.11.0.02,11.04,9.014,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16,18,20,22-undecaen-7-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc2cc3c(cc2c1)sc1c2cc4ccccc4cc2sc31 |
| InChI | InChI=1S/C27H20S2Si/c1-30(2,3)11-10-17-8-9-20-14-23-25(16-21(20)12-17)29-26-22-13-18-6-4-5-7-19(18)15-24(22)28-27(23)26/h4-9,12-16H,1-3H3 |
| InChIKey | OMYDJFXIAKEWRO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|