C23H20Si — CID 66552882
2-chrysen-5-yl(1,2-13C2)ethynyl(trimethyl)silane (PubChem CID 66552882) has the molecular formula C23H20Si and a molecular weight of 328.47 g/mol. Its IUPAC name is 2-chrysen-5-yl(1,2-13C2)ethynyl(trimethyl)silane.
| Compound Name | 2-chrysen-5-yl(1,2-13C2)ethynyl(trimethyl)silane |
|---|---|
| PubChem CID | 66552882 |
| Molecular Formula | C23H20Si |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-chrysen-5-yl(1,2-13C2)ethynyl(trimethyl)silane |
| SMILES | C[Si](C)(C)[13C]#[13C][13c]1[13cH]c2ccccc2c2ccc3ccccc3c21 |
| InChI | InChI=1S/C23H20Si/c1-24(2,3)15-14-19-16-18-9-5-6-10-20(18)22-13-12-17-8-4-7-11-21(17)23(19)22/h4-13,16H,1-3H3/i14+1,15+1,16+1,19+1 |
| InChIKey | INRMXYXVGMATPD-NVROMGPOSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|