C19H20F3NO5S — CID 146374445
[3-(2-methylprop-2-enoyloxy)-5-[3-oxo-4-(trifluoromethylsulfanylamino)butyl]phenyl] 2-methylprop-2-enoate (PubChem CID 146374445) has the molecular formula C19H20F3NO5S and a molecular weight of 431.43 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-5-[3-oxo-4-(trifluoromethylsulfanylamino)butyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-5-[3-oxo-4-(trifluoromethylsulfanylamino)butyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146374445 |
| Molecular Formula | C19H20F3NO5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-5-[3-oxo-4-(trifluoromethylsulfanylamino)butyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(CCC(=O)CNSC(F)(F)F)cc(OC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C19H20F3NO5S/c1-11(2)17(25)27-15-7-13(8-16(9-15)28-18(26)12(3)4)5-6-14(24)10-23-29-19(20,21)22/h7-9,23H,1,3,5-6,10H2,2,4H3 |
| InChIKey | SFEGZHTWBCPDIA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|