C19H25NO6 — CID 146374359
[3-(1-hydroxyprop-2-enoxy)-5-[5-(methylcarbamoyloxy)pentyl]phenyl] prop-2-enoate (PubChem CID 146374359) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is [3-(1-hydroxyprop-2-enoxy)-5-[5-(methylcarbamoyloxy)pentyl]phenyl] prop-2-enoate.
| Compound Name | [3-(1-hydroxyprop-2-enoxy)-5-[5-(methylcarbamoyloxy)pentyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146374359 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [3-(1-hydroxyprop-2-enoxy)-5-[5-(methylcarbamoyloxy)pentyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(CCCCCOC(=O)NC)cc(OC(O)C=C)c1 |
| InChI | InChI=1S/C19H25NO6/c1-4-17(21)25-15-11-14(12-16(13-15)26-18(22)5-2)9-7-6-8-10-24-19(23)20-3/h4-5,11-13,17,21H,1-2,6-10H2,3H3,(H,20,23) |
| InChIKey | PGWDTAOVZBZDON-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|