C24H24O4 — CID 126515036
[7-[4-(1-hydroxyprop-2-enoxy)butyl]phenanthren-2-yl] prop-2-enoate (PubChem CID 126515036) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is [7-[4-(1-hydroxyprop-2-enoxy)butyl]phenanthren-2-yl] prop-2-enoate.
| Compound Name | [7-[4-(1-hydroxyprop-2-enoxy)butyl]phenanthren-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 126515036 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [7-[4-(1-hydroxyprop-2-enoxy)butyl]phenanthren-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc2c(ccc3cc(CCCCOC(O)C=C)ccc32)c1 |
| InChI | InChI=1S/C24H24O4/c1-3-23(25)27-14-6-5-7-17-8-12-21-18(15-17)9-10-19-16-20(11-13-22(19)21)28-24(26)4-2/h3-4,8-13,15-16,23,25H,1-2,5-7,14H2 |
| InChIKey | QXHLWLMVXGYRQB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|