C24H24O4 — CID 123250548
[7-(4-acetyloxybutyl)phenanthren-2-yl] 2-methylprop-2-enoate (PubChem CID 123250548) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is [7-(4-acetyloxybutyl)phenanthren-2-yl] 2-methylprop-2-enoate.
| Compound Name | [7-(4-acetyloxybutyl)phenanthren-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123250548 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [7-(4-acetyloxybutyl)phenanthren-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(ccc3cc(CCCCOC(C)=O)ccc32)c1 |
| InChI | InChI=1S/C24H24O4/c1-16(2)24(26)28-21-10-12-23-20(15-21)9-8-19-14-18(7-11-22(19)23)6-4-5-13-27-17(3)25/h7-12,14-15H,1,4-6,13H2,2-3H3 |
| InChIKey | MFKBDVLLCWYVQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|