C27H28O4 — CID 129228623
4-[8-(2-methylprop-2-enoyloxy)-11H-cyclohepta[a]naphthalen-3-yl]butyl 2-methylprop-2-enoate (PubChem CID 129228623) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[8-(2-methylprop-2-enoyloxy)-11H-cyclohepta[a]naphthalen-3-yl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[8-(2-methylprop-2-enoyloxy)-11H-cyclohepta[a]naphthalen-3-yl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129228623 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-[8-(2-methylprop-2-enoyloxy)-11H-cyclohepta[a]naphthalen-3-yl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCc1ccc2c3c(ccc2c1)C=C(OC(=O)C(=C)C)C=CC3 |
| InChI | InChI=1S/C27H28O4/c1-18(2)26(28)30-15-6-5-8-20-11-14-25-21(16-20)12-13-22-17-23(9-7-10-24(22)25)31-27(29)19(3)4/h7,9,11-14,16-17H,1,3,5-6,8,10,15H2,2,4H3 |
| InChIKey | OQJPHAOUYRPTEI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|