C28H24O10 — CID 130281799
[3-(1-hydroxyprop-2-enoxy)-5-prop-2-enoyloxyphenyl] (E)-3-[3,5-di(prop-2-enoyloxy)phenyl]but-2-enoate (PubChem CID 130281799) has the molecular formula C28H24O10 and a molecular weight of 520.49 g/mol. Its IUPAC name is [3-(1-hydroxyprop-2-enoxy)-5-prop-2-enoyloxyphenyl] (E)-3-[3,5-di(prop-2-enoyloxy)phenyl]but-2-enoate.
| Compound Name | [3-(1-hydroxyprop-2-enoxy)-5-prop-2-enoyloxyphenyl] (E)-3-[3,5-di(prop-2-enoyloxy)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 130281799 |
| Molecular Formula | C28H24O10 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [3-(1-hydroxyprop-2-enoxy)-5-prop-2-enoyloxyphenyl] (E)-3-[3,5-di(prop-2-enoyloxy)phenyl]but-2-enoate |
| SMILES | C=CC(=O)Oc1cc(OC(=O)/C=C(\C)c2cc(OC(=O)C=C)cc(OC(=O)C=C)c2)cc(OC(O)C=C)c1 |
| InChI | InChI=1S/C28H24O10/c1-6-24(29)34-19-11-18(12-20(13-19)35-25(30)7-2)17(5)10-28(33)38-23-15-21(36-26(31)8-3)14-22(16-23)37-27(32)9-4/h6-16,26,31H,1-4H2,5H3/b17-10+ |
| InChIKey | SWDPJJNCHQEIST-LICLKQGHSA-N |
| XLogP | 3.85 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|