C18H10Cl4O4 — CID 70544531
[3,5-dichloro-4-(2,6-dichloro-4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate (PubChem CID 70544531) has the molecular formula C18H10Cl4O4 and a molecular weight of 432.09 g/mol. Its IUPAC name is [3,5-dichloro-4-(2,6-dichloro-4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate.
| Compound Name | [3,5-dichloro-4-(2,6-dichloro-4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 70544531 |
| Molecular Formula | C18H10Cl4O4 |
| Molecular Weight | 432.09 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | [3,5-dichloro-4-(2,6-dichloro-4-prop-2-enoyloxyphenyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(Cl)c(-c2c(Cl)cc(OC(=O)C=C)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl4O4/c1-3-15(23)25-9-5-11(19)17(12(20)6-9)18-13(21)7-10(8-14(18)22)26-16(24)4-2/h3-8H,1-2H2 |
| InChIKey | FQKOBSHMVAANAQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.09 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|