C18H22O6 — CID 155571960
ethane;propyl 3,5-di(prop-2-enoyloxy)benzoate (PubChem CID 155571960) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is ethane;propyl 3,5-di(prop-2-enoyloxy)benzoate.
| Compound Name | ethane;propyl 3,5-di(prop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 155571960 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethane;propyl 3,5-di(prop-2-enoyloxy)benzoate |
| SMILES | C=CC(=O)Oc1cc(OC(=O)C=C)cc(C(=O)OCCC)c1.CC |
| InChI | InChI=1S/C16H16O6.C2H6/c1-4-7-20-16(19)11-8-12(21-14(17)5-2)10-13(9-11)22-15(18)6-3;1-2/h5-6,8-10H,2-4,7H2,1H3;1-2H3 |
| InChIKey | VWZNTIVJKMZSHU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|