C23H32O8 — CID 159528146
bis(1-butoxyethyl) 5-prop-2-enoyloxybenzene-1,3-dicarboxylate (PubChem CID 159528146) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is bis(1-butoxyethyl) 5-prop-2-enoyloxybenzene-1,3-dicarboxylate.
| Compound Name | bis(1-butoxyethyl) 5-prop-2-enoyloxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 159528146 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | bis(1-butoxyethyl) 5-prop-2-enoyloxybenzene-1,3-dicarboxylate |
| SMILES | C=CC(=O)Oc1cc(C(=O)OC(C)OCCCC)cc(C(=O)OC(C)OCCCC)c1 |
| InChI | InChI=1S/C23H32O8/c1-6-9-11-27-16(4)29-22(25)18-13-19(15-20(14-18)31-21(24)8-3)23(26)30-17(5)28-12-10-7-2/h8,13-17H,3,6-7,9-12H2,1-2,4-5H3 |
| InChIKey | MCQIMUHYOYPGSP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|