C18H18F3NO5 — CID 146374444
[3-prop-2-enoyloxy-5-[propyl(2,2,2-trifluoroethyl)carbamoyl]phenyl] prop-2-enoate (PubChem CID 146374444) has the molecular formula C18H18F3NO5 and a molecular weight of 385.34 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-5-[propyl(2,2,2-trifluoroethyl)carbamoyl]phenyl] prop-2-enoate.
| Compound Name | [3-prop-2-enoyloxy-5-[propyl(2,2,2-trifluoroethyl)carbamoyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146374444 |
| Molecular Formula | C18H18F3NO5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [3-prop-2-enoyloxy-5-[propyl(2,2,2-trifluoroethyl)carbamoyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(OC(=O)C=C)cc(C(=O)N(CCC)CC(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO5/c1-4-7-22(11-18(19,20)21)17(25)12-8-13(26-15(23)5-2)10-14(9-12)27-16(24)6-3/h5-6,8-10H,2-4,7,11H2,1H3 |
| InChIKey | CVWRZVOQYBWTMG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|