C7H12F3NO6S2 — CID 59046676
2-(2-ethenoxyethoxy)-N-(trifluoromethylsulfonyl)ethanesulfonamide (PubChem CID 59046676) has the molecular formula C7H12F3NO6S2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-(2-ethenoxyethoxy)-N-(trifluoromethylsulfonyl)ethanesulfonamide.
| Compound Name | 2-(2-ethenoxyethoxy)-N-(trifluoromethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 59046676 |
| Molecular Formula | C7H12F3NO6S2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-(2-ethenoxyethoxy)-N-(trifluoromethylsulfonyl)ethanesulfonamide |
| SMILES | C=COCCOCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO6S2/c1-2-16-3-4-17-5-6-18(12,13)11-19(14,15)7(8,9)10/h2,11H,1,3-6H2 |
| InChIKey | ZMAJGGFMNWUIRQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|